C25H24N2O5 — CID 169333206
ethyl 4-(4-benzoylpiperazin-1-yl)-3-(5-formylfuran-2-yl)benzoate (PubChem CID 169333206) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is ethyl 4-(4-benzoylpiperazin-1-yl)-3-(5-formylfuran-2-yl)benzoate.
| Compound Name | ethyl 4-(4-benzoylpiperazin-1-yl)-3-(5-formylfuran-2-yl)benzoate |
|---|---|
| PubChem CID | 169333206 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | ethyl 4-(4-benzoylpiperazin-1-yl)-3-(5-formylfuran-2-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCN(C(=O)c3ccccc3)CC2)c(-c2ccc(C=O)o2)c1 |
| InChI | InChI=1S/C25H24N2O5/c1-2-31-25(30)19-8-10-22(21(16-19)23-11-9-20(17-28)32-23)26-12-14-27(15-13-26)24(29)18-6-4-3-5-7-18/h3-11,16-17H,2,12-15H2,1H3 |
| InChIKey | JPCFKAIXJOKXPP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|