C27H28N4O4 — CID 42767164
ethyl 4-[[4-(4-benzoylpiperazin-1-yl)phenyl]carbamoylamino]benzoate (PubChem CID 42767164) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is ethyl 4-[[4-(4-benzoylpiperazin-1-yl)phenyl]carbamoylamino]benzoate.
| Compound Name | ethyl 4-[[4-(4-benzoylpiperazin-1-yl)phenyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 42767164 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | ethyl 4-[[4-(4-benzoylpiperazin-1-yl)phenyl]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Nc2ccc(N3CCN(C(=O)c4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H28N4O4/c1-2-35-26(33)21-8-10-22(11-9-21)28-27(34)29-23-12-14-24(15-13-23)30-16-18-31(19-17-30)25(32)20-6-4-3-5-7-20/h3-15H,2,16-19H2,1H3,(H2,28,29,34) |
| InChIKey | NKWQSORDENCHJX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|