C30H30N4O2 — CID 1056891
1-(4-ethylphenyl)-3-[4-[4-(naphthalene-2-carbonyl)piperazin-1-yl]phenyl]urea (PubChem CID 1056891) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[4-[4-(naphthalene-2-carbonyl)piperazin-1-yl]phenyl]urea.
| Compound Name | 1-(4-ethylphenyl)-3-[4-[4-(naphthalene-2-carbonyl)piperazin-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 1056891 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[4-[4-(naphthalene-2-carbonyl)piperazin-1-yl]phenyl]urea |
| SMILES | CCc1ccc(NC(=O)Nc2ccc(N3CCN(C(=O)c4ccc5ccccc5c4)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H30N4O2/c1-2-22-7-11-26(12-8-22)31-30(36)32-27-13-15-28(16-14-27)33-17-19-34(20-18-33)29(35)25-10-9-23-5-3-4-6-24(23)21-25/h3-16,21H,2,17-20H2,1H3,(H2,31,32,36) |
| InChIKey | QQJTVOVZWMKOJX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|