C28H32N4O2 — CID 1057995
1-(4-ethylphenyl)-3-[4-[4-[2-(2-methylphenyl)acetyl]piperazin-1-yl]phenyl]urea (PubChem CID 1057995) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[4-[4-[2-(2-methylphenyl)acetyl]piperazin-1-yl]phenyl]urea.
| Compound Name | 1-(4-ethylphenyl)-3-[4-[4-[2-(2-methylphenyl)acetyl]piperazin-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 1057995 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[4-[4-[2-(2-methylphenyl)acetyl]piperazin-1-yl]phenyl]urea |
| SMILES | CCc1ccc(NC(=O)Nc2ccc(N3CCN(C(=O)Cc4ccccc4C)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H32N4O2/c1-3-22-8-10-24(11-9-22)29-28(34)30-25-12-14-26(15-13-25)31-16-18-32(19-17-31)27(33)20-23-7-5-4-6-21(23)2/h4-15H,3,16-20H2,1-2H3,(H2,29,30,34) |
| InChIKey | UOBYLTFUPVUHFW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|