C33H32N4O3 — CID 1058024
1-(4-ethylphenyl)-3-[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]urea (PubChem CID 1058024) has the molecular formula C33H32N4O3 and a molecular weight of 532.64 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]urea.
| Compound Name | 1-(4-ethylphenyl)-3-[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 1058024 |
| Molecular Formula | C33H32N4O3 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]urea |
| SMILES | CCc1ccc(NC(=O)Nc2ccc(N3CCN(C(=O)C4c5ccccc5Oc5ccccc54)CC3)cc2)cc1 |
| InChI | InChI=1S/C33H32N4O3/c1-2-23-11-13-24(14-12-23)34-33(39)35-25-15-17-26(18-16-25)36-19-21-37(22-20-36)32(38)31-27-7-3-5-9-29(27)40-30-10-6-4-8-28(30)31/h3-18,31H,2,19-22H2,1H3,(H2,34,35,39) |
| InChIKey | YPQXHOCPPRBQBZ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|