C31H26BrN3O3 — CID 1057861
3-bromo-N-[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 1057861) has the molecular formula C31H26BrN3O3 and a molecular weight of 568.47 g/mol. Its IUPAC name is 3-bromo-N-[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 3-bromo-N-[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 1057861 |
| Molecular Formula | C31H26BrN3O3 |
| Molecular Weight | 568.47 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | 3-bromo-N-[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)C3c4ccccc4Oc4ccccc43)CC2)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C31H26BrN3O3/c32-22-7-5-6-21(20-22)30(36)33-23-12-14-24(15-13-23)34-16-18-35(19-17-34)31(37)29-25-8-1-3-10-27(25)38-28-11-4-2-9-26(28)29/h1-15,20,29H,16-19H2,(H,33,36) |
| InChIKey | IQYSVIQXLPGKGH-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.47 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|