C29H31N3O3 — CID 1057849
2,2-dimethyl-N-[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]propanamide (PubChem CID 1057849) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 1057849 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 2,2-dimethyl-N-[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]propanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(N2CCN(C(=O)C3c4ccccc4Oc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C29H31N3O3/c1-29(2,3)28(34)30-20-12-14-21(15-13-20)31-16-18-32(19-17-31)27(33)26-22-8-4-6-10-24(22)35-25-11-7-5-9-23(25)26/h4-15,26H,16-19H2,1-3H3,(H,30,34) |
| InChIKey | OMFWDZZXEPGZJZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|