C21H23F2N3O2 — CID 108964923
N-(4-fluorophenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]-2,2-dimethyl-3-oxopropanamide (PubChem CID 108964923) has the molecular formula C21H23F2N3O2 and a molecular weight of 387.43 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]-2,2-dimethyl-3-oxopropanamide.
| Compound Name | N-(4-fluorophenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]-2,2-dimethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 108964923 |
| Molecular Formula | C21H23F2N3O2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-(4-fluorophenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]-2,2-dimethyl-3-oxopropanamide |
| SMILES | CC(C)(C(=O)Nc1ccc(F)cc1)C(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H23F2N3O2/c1-21(2,19(27)24-17-7-3-15(22)4-8-17)20(28)26-13-11-25(12-14-26)18-9-5-16(23)6-10-18/h3-10H,11-14H2,1-2H3,(H,24,27) |
| InChIKey | ADHSGOOIFKORLY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|