C22H27N3O2 — CID 108967489
2,2-dimethyl-N-(4-methylphenyl)-N'-(4-pyrrolidin-1-ylphenyl)propanediamide (PubChem CID 108967489) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 2,2-dimethyl-N-(4-methylphenyl)-N'-(4-pyrrolidin-1-ylphenyl)propanediamide.
| Compound Name | 2,2-dimethyl-N-(4-methylphenyl)-N'-(4-pyrrolidin-1-ylphenyl)propanediamide |
|---|---|
| PubChem CID | 108967489 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 2,2-dimethyl-N-(4-methylphenyl)-N'-(4-pyrrolidin-1-ylphenyl)propanediamide |
| SMILES | Cc1ccc(NC(=O)C(C)(C)C(=O)Nc2ccc(N3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C22H27N3O2/c1-16-6-8-17(9-7-16)23-20(26)22(2,3)21(27)24-18-10-12-19(13-11-18)25-14-4-5-15-25/h6-13H,4-5,14-15H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | YFWVHUHKPXFXHF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|