C23H29N3O3 — CID 108969323
N-(2-methoxyphenyl)-2,2-dimethyl-N'-(4-piperidin-1-ylphenyl)propanediamide (PubChem CID 108969323) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2,2-dimethyl-N'-(4-piperidin-1-ylphenyl)propanediamide.
| Compound Name | N-(2-methoxyphenyl)-2,2-dimethyl-N'-(4-piperidin-1-ylphenyl)propanediamide |
|---|---|
| PubChem CID | 108969323 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-(2-methoxyphenyl)-2,2-dimethyl-N'-(4-piperidin-1-ylphenyl)propanediamide |
| SMILES | COc1ccccc1NC(=O)C(C)(C)C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-23(2,22(28)25-19-9-5-6-10-20(19)29-3)21(27)24-17-11-13-18(14-12-17)26-15-7-4-8-16-26/h5-6,9-14H,4,7-8,15-16H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | WQCCBQDVUYUTGV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|