C23H26N4O2 — CID 108969928
N-(2-cyanophenyl)-2,2-dimethyl-N'-(4-piperidin-1-ylphenyl)propanediamide (PubChem CID 108969928) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2,2-dimethyl-N'-(4-piperidin-1-ylphenyl)propanediamide.
| Compound Name | N-(2-cyanophenyl)-2,2-dimethyl-N'-(4-piperidin-1-ylphenyl)propanediamide |
|---|---|
| PubChem CID | 108969928 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-(2-cyanophenyl)-2,2-dimethyl-N'-(4-piperidin-1-ylphenyl)propanediamide |
| SMILES | CC(C)(C(=O)Nc1ccc(N2CCCCC2)cc1)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C23H26N4O2/c1-23(2,22(29)26-20-9-5-4-8-17(20)16-24)21(28)25-18-10-12-19(13-11-18)27-14-6-3-7-15-27/h4-5,8-13H,3,6-7,14-15H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | YRZPWHFWEQJNOS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|