C22H25N3O2 — CID 108968687
N-(4-tert-butylphenyl)-N'-(2-cyanophenyl)-2,2-dimethylpropanediamide (PubChem CID 108968687) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N'-(2-cyanophenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(4-tert-butylphenyl)-N'-(2-cyanophenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108968687 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N-(4-tert-butylphenyl)-N'-(2-cyanophenyl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)Nc1ccc(C(C)(C)C)cc1)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C22H25N3O2/c1-21(2,3)16-10-12-17(13-11-16)24-19(26)22(4,5)20(27)25-18-9-7-6-8-15(18)14-23/h6-13H,1-5H3,(H,24,26)(H,25,27) |
| InChIKey | ZGGBWLVAKAFHRY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|