C18H15ClFN3O2 — CID 108969217
N-(3-chloro-4-fluorophenyl)-N'-(2-cyanophenyl)-2,2-dimethylpropanediamide (PubChem CID 108969217) has the molecular formula C18H15ClFN3O2 and a molecular weight of 359.79 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-N'-(2-cyanophenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-N'-(2-cyanophenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108969217 |
| Molecular Formula | C18H15ClFN3O2 |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-N'-(2-cyanophenyl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)Nc1ccc(F)c(Cl)c1)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C18H15ClFN3O2/c1-18(2,16(24)22-12-7-8-14(20)13(19)9-12)17(25)23-15-6-4-3-5-11(15)10-21/h3-9H,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | RHCAUFGWWOOINL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|