C22H28N4O2 — CID 108963754
2,2-dimethyl-N-(4-piperidin-1-ylphenyl)-N'-(pyridin-4-ylmethyl)propanediamide (PubChem CID 108963754) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2,2-dimethyl-N-(4-piperidin-1-ylphenyl)-N'-(pyridin-4-ylmethyl)propanediamide.
| Compound Name | 2,2-dimethyl-N-(4-piperidin-1-ylphenyl)-N'-(pyridin-4-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 108963754 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2,2-dimethyl-N-(4-piperidin-1-ylphenyl)-N'-(pyridin-4-ylmethyl)propanediamide |
| SMILES | CC(C)(C(=O)NCc1ccncc1)C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H28N4O2/c1-22(2,20(27)24-16-17-10-12-23-13-11-17)21(28)25-18-6-8-19(9-7-18)26-14-4-3-5-15-26/h6-13H,3-5,14-16H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | YKAJTLJUVZTAOI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|