C17H25ClN2O — CID 63679380
N-[4-(azepan-1-yl)phenyl]-3-chloro-2,2-dimethylpropanamide (PubChem CID 63679380) has the molecular formula C17H25ClN2O and a molecular weight of 308.85 g/mol. Its IUPAC name is N-[4-(azepan-1-yl)phenyl]-3-chloro-2,2-dimethylpropanamide.
| Compound Name | N-[4-(azepan-1-yl)phenyl]-3-chloro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 63679380 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-[4-(azepan-1-yl)phenyl]-3-chloro-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)Nc1ccc(N2CCCCCC2)cc1 |
| InChI | InChI=1S/C17H25ClN2O/c1-17(2,13-18)16(21)19-14-7-9-15(10-8-14)20-11-5-3-4-6-12-20/h7-10H,3-6,11-13H2,1-2H3,(H,19,21) |
| InChIKey | RJBQUMOUDNPXIP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|