C14H20ClN3O — CID 63679043
3-chloro-2,2-dimethyl-N-(6-pyrrolidin-1-yl-3-pyridinyl)propanamide (PubChem CID 63679043) has the molecular formula C14H20ClN3O and a molecular weight of 281.79 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-(6-pyrrolidin-1-yl-3-pyridinyl)propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-(6-pyrrolidin-1-yl-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 63679043 |
| Molecular Formula | C14H20ClN3O |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-(6-pyrrolidin-1-yl-3-pyridinyl)propanamide |
| SMILES | CC(C)(CCl)C(=O)Nc1ccc(N2CCCC2)nc1 |
| InChI | InChI=1S/C14H20ClN3O/c1-14(2,10-15)13(19)17-11-5-6-12(16-9-11)18-7-3-4-8-18/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,17,19) |
| InChIKey | TWLYWINAQAWPFK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|