C16H26N4O — CID 103928716
(2R)-2-amino-3,3-dimethyl-N-(6-piperidin-1-yl-3-pyridinyl)butanamide (PubChem CID 103928716) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is (2R)-2-amino-3,3-dimethyl-N-(6-piperidin-1-yl-3-pyridinyl)butanamide.
| Compound Name | (2R)-2-amino-3,3-dimethyl-N-(6-piperidin-1-yl-3-pyridinyl)butanamide |
|---|---|
| PubChem CID | 103928716 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (2R)-2-amino-3,3-dimethyl-N-(6-piperidin-1-yl-3-pyridinyl)butanamide |
| SMILES | CC(C)(C)[C@@H](N)C(=O)Nc1ccc(N2CCCCC2)nc1 |
| InChI | InChI=1S/C16H26N4O/c1-16(2,3)14(17)15(21)19-12-7-8-13(18-11-12)20-9-5-4-6-10-20/h7-8,11,14H,4-6,9-10,17H2,1-3H3,(H,19,21)/t14-/m0/s1 |
| InChIKey | OJFANQBKBQZGTK-AWEZNQCLSA-N |
| XLogP | 2.38 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |