C11H16FN3O — CID 103808708
(2S)-2-amino-N-(6-fluoro-3-pyridinyl)-3,3-dimethylbutanamide (PubChem CID 103808708) has the molecular formula C11H16FN3O and a molecular weight of 225.27 g/mol. Its IUPAC name is (2S)-2-amino-N-(6-fluoro-3-pyridinyl)-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-(6-fluoro-3-pyridinyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 103808708 |
| Molecular Formula | C11H16FN3O |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | (2S)-2-amino-N-(6-fluoro-3-pyridinyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)Nc1ccc(F)nc1 |
| InChI | InChI=1S/C11H16FN3O/c1-11(2,3)9(13)10(16)15-7-4-5-8(12)14-6-7/h4-6,9H,13H2,1-3H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | KFWSJVBHXBEYRO-SECBINFHSA-N |
| XLogP | 1.53 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|