C12H16F2N2O — CID 103928376
(2R)-2-amino-N-(3,5-difluorophenyl)-3,3-dimethylbutanamide (PubChem CID 103928376) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is (2R)-2-amino-N-(3,5-difluorophenyl)-3,3-dimethylbutanamide.
| Compound Name | (2R)-2-amino-N-(3,5-difluorophenyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 103928376 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (2R)-2-amino-N-(3,5-difluorophenyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@@H](N)C(=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H16F2N2O/c1-12(2,3)10(15)11(17)16-9-5-7(13)4-8(14)6-9/h4-6,10H,15H2,1-3H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | JYDJQULTEOHDSZ-JTQLQIEISA-N |
| XLogP | 2.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |