C14H20F2N2O — CID 62614363
(2S)-2-amino-N-[2-(3,5-difluorophenyl)ethyl]-3,3-dimethylbutanamide (PubChem CID 62614363) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(3,5-difluorophenyl)ethyl]-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-(3,5-difluorophenyl)ethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 62614363 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (2S)-2-amino-N-[2-(3,5-difluorophenyl)ethyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)NCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H20F2N2O/c1-14(2,3)12(17)13(19)18-5-4-9-6-10(15)8-11(16)7-9/h6-8,12H,4-5,17H2,1-3H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | KQNAAZMAIWXGSO-GFCCVEGCSA-N |
| XLogP | 2.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |