C18H30N2O — CID 119706734
(2S)-2-amino-N-[2-(4-tert-butylphenyl)ethyl]-3,3-dimethylbutanamide (PubChem CID 119706734) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(4-tert-butylphenyl)ethyl]-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-(4-tert-butylphenyl)ethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 119706734 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | (2S)-2-amino-N-[2-(4-tert-butylphenyl)ethyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)c1ccc(CCNC(=O)[C@@H](N)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H30N2O/c1-17(2,3)14-9-7-13(8-10-14)11-12-20-16(21)15(19)18(4,5)6/h7-10,15H,11-12,19H2,1-6H3,(H,20,21)/t15-/m1/s1 |
| InChIKey | QHYIVLVPQJZCSP-OAHLLOKOSA-N |
| XLogP | 3.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |