C15H21F2NO — CID 70921104
2-[2-(3,5-difluorophenyl)ethyl]-N,3,3-trimethylbutanamide (PubChem CID 70921104) has the molecular formula C15H21F2NO and a molecular weight of 269.33 g/mol. Its IUPAC name is 2-[2-(3,5-difluorophenyl)ethyl]-N,3,3-trimethylbutanamide.
| Compound Name | 2-[2-(3,5-difluorophenyl)ethyl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 70921104 |
| Molecular Formula | C15H21F2NO |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-[2-(3,5-difluorophenyl)ethyl]-N,3,3-trimethylbutanamide |
| SMILES | CNC(=O)C(CCc1cc(F)cc(F)c1)C(C)(C)C |
| InChI | InChI=1S/C15H21F2NO/c1-15(2,3)13(14(19)18-4)6-5-10-7-11(16)9-12(17)8-10/h7-9,13H,5-6H2,1-4H3,(H,18,19) |
| InChIKey | IUMXWRDMMROUIY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |