C13H19FN2O — CID 103789664
N-(6-fluoro-3-pyridinyl)-3,4,4-trimethylpentanamide (PubChem CID 103789664) has the molecular formula C13H19FN2O and a molecular weight of 238.31 g/mol. Its IUPAC name is N-(6-fluoro-3-pyridinyl)-3,4,4-trimethylpentanamide.
| Compound Name | N-(6-fluoro-3-pyridinyl)-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 103789664 |
| Molecular Formula | C13H19FN2O |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-(6-fluoro-3-pyridinyl)-3,4,4-trimethylpentanamide |
| SMILES | CC(CC(=O)Nc1ccc(F)nc1)C(C)(C)C |
| InChI | InChI=1S/C13H19FN2O/c1-9(13(2,3)4)7-12(17)16-10-5-6-11(14)15-8-10/h5-6,8-9H,7H2,1-4H3,(H,16,17) |
| InChIKey | DWLOKSFCOIBEIP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|