C14H16F4N2O — CID 103731896
2,2,3,3-tetrafluoro-N-(4-piperidin-1-ylphenyl)propanamide (PubChem CID 103731896) has the molecular formula C14H16F4N2O and a molecular weight of 304.29 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(4-piperidin-1-ylphenyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(4-piperidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 103731896 |
| Molecular Formula | C14H16F4N2O |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(4-piperidin-1-ylphenyl)propanamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H16F4N2O/c15-12(16)14(17,18)13(21)19-10-4-6-11(7-5-10)20-8-2-1-3-9-20/h4-7,12H,1-3,8-9H2,(H,19,21) |
| InChIKey | ZBGNZNAKTKETRM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|