C13H16Cl2N2O — CID 1480241
2,2-dichloro-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 1480241) has the molecular formula C13H16Cl2N2O and a molecular weight of 287.19 g/mol. Its IUPAC name is 2,2-dichloro-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2,2-dichloro-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 1480241 |
| Molecular Formula | C13H16Cl2N2O |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2,2-dichloro-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)C(Cl)Cl |
| InChI | InChI=1S/C13H16Cl2N2O/c14-12(15)13(18)16-10-4-6-11(7-5-10)17-8-2-1-3-9-17/h4-7,12H,1-3,8-9H2,(H,16,18) |
| InChIKey | MRYKQSLWKVUBON-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|