C20H32N3O+ — CID 9267789
(2S)-2-(azepan-1-ium-1-yl)-N-(4-piperidin-1-ylphenyl)propanamide (PubChem CID 9267789) has the molecular formula C20H32N3O+ and a molecular weight of 330.50 g/mol. Its IUPAC name is (2S)-2-(azepan-1-ium-1-yl)-N-(4-piperidin-1-ylphenyl)propanamide.
| Compound Name | (2S)-2-(azepan-1-ium-1-yl)-N-(4-piperidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 9267789 |
| Molecular Formula | C20H32N3O+ |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | (2S)-2-(azepan-1-ium-1-yl)-N-(4-piperidin-1-ylphenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(N2CCCCC2)cc1)[NH+]1CCCCCC1 |
| InChI | InChI=1S/C20H31N3O/c1-17(22-13-5-2-3-6-14-22)20(24)21-18-9-11-19(12-10-18)23-15-7-4-8-16-23/h9-12,17H,2-8,13-16H2,1H3,(H,21,24)/p+1/t17-/m0/s1 |
| InChIKey | GXDZBXHITUVSJG-KRWDZBQOSA-O |
| XLogP | 2.46 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|