C24H33N4O2+ — CID 8725307
(2R)-2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 8725307) has the molecular formula C24H33N4O2+ and a molecular weight of 409.55 g/mol. Its IUPAC name is (2R)-2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | (2R)-2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 8725307 |
| Molecular Formula | C24H33N4O2+ |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | (2R)-2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | Cc1ccccc1N1CC[NH+]([C@H](C)C(=O)Nc2ccc(N3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C24H32N4O2/c1-19-5-3-4-6-23(19)28-13-11-26(12-14-28)20(2)24(29)25-21-7-9-22(10-8-21)27-15-17-30-18-16-27/h3-10,20H,11-18H2,1-2H3,(H,25,29)/p+1/t20-/m1/s1 |
| InChIKey | COBGIYQQGMAJPE-HXUWFJFHSA-O |
| XLogP | 1.56 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|