C21H25F3N3O+ — CID 8725347
(2S)-2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 8725347) has the molecular formula C21H25F3N3O+ and a molecular weight of 392.45 g/mol. Its IUPAC name is (2S)-2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2S)-2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 8725347 |
| Molecular Formula | C21H25F3N3O+ |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | (2S)-2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | Cc1ccccc1N1CC[NH+]([C@@H](C)C(=O)Nc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H24F3N3O/c1-15-5-3-4-6-19(15)27-13-11-26(12-14-27)16(2)20(28)25-18-9-7-17(8-10-18)21(22,23)24/h3-10,16H,11-14H2,1-2H3,(H,25,28)/p+1/t16-/m0/s1 |
| InChIKey | OOUNHDFJYCBPRS-INIZCTEOSA-O |
| XLogP | 2.75 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |