C19H27N3O4S — CID 108964695
N-(1,1-dioxothiolan-3-yl)-2,2-dimethyl-N'-(4-pyrrolidin-1-ylphenyl)propanediamide (PubChem CID 108964695) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2,2-dimethyl-N'-(4-pyrrolidin-1-ylphenyl)propanediamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2,2-dimethyl-N'-(4-pyrrolidin-1-ylphenyl)propanediamide |
|---|---|
| PubChem CID | 108964695 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2,2-dimethyl-N'-(4-pyrrolidin-1-ylphenyl)propanediamide |
| SMILES | CC(C)(C(=O)Nc1ccc(N2CCCC2)cc1)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H27N3O4S/c1-19(2,18(24)21-15-9-12-27(25,26)13-15)17(23)20-14-5-7-16(8-6-14)22-10-3-4-11-22/h5-8,15H,3-4,9-13H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | JWWQOPYQTIEQSJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|