C18H27N3O3S — CID 40809505
(2S)-N-[(3R)-1,1-dioxothiolan-3-yl]-2-(4-piperidin-1-ylanilino)propanamide (PubChem CID 40809505) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is (2S)-N-[(3R)-1,1-dioxothiolan-3-yl]-2-(4-piperidin-1-ylanilino)propanamide.
| Compound Name | (2S)-N-[(3R)-1,1-dioxothiolan-3-yl]-2-(4-piperidin-1-ylanilino)propanamide |
|---|---|
| PubChem CID | 40809505 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (2S)-N-[(3R)-1,1-dioxothiolan-3-yl]-2-(4-piperidin-1-ylanilino)propanamide |
| SMILES | C[C@H](Nc1ccc(N2CCCCC2)cc1)C(=O)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H27N3O3S/c1-14(18(22)20-16-9-12-25(23,24)13-16)19-15-5-7-17(8-6-15)21-10-3-2-4-11-21/h5-8,14,16,19H,2-4,9-13H2,1H3,(H,20,22)/t14-,16+/m0/s1 |
| InChIKey | VVBQOUDKUGJYIZ-GOEBONIOSA-N |
| XLogP | 1.78 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|