C18H29N3O — CID 40809510
(2R)-N-tert-butyl-2-(4-piperidin-1-ylanilino)propanamide (PubChem CID 40809510) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is (2R)-N-tert-butyl-2-(4-piperidin-1-ylanilino)propanamide.
| Compound Name | (2R)-N-tert-butyl-2-(4-piperidin-1-ylanilino)propanamide |
|---|---|
| PubChem CID | 40809510 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | (2R)-N-tert-butyl-2-(4-piperidin-1-ylanilino)propanamide |
| SMILES | C[C@@H](Nc1ccc(N2CCCCC2)cc1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H29N3O/c1-14(17(22)20-18(2,3)4)19-15-8-10-16(11-9-15)21-12-6-5-7-13-21/h8-11,14,19H,5-7,12-13H2,1-4H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | PRMYDDABRWONAV-CQSZACIVSA-N |
| XLogP | 3.39 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|