C17H24N2O3S — CID 42335959
2-[(3R)-1,1-dioxothiolan-3-yl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 42335959) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 42335959 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C17H24N2O3S/c20-17(12-14-8-11-23(21,22)13-14)18-15-4-6-16(7-5-15)19-9-2-1-3-10-19/h4-7,14H,1-3,8-13H2,(H,18,20)/t14-/m0/s1 |
| InChIKey | WOKBMHPEPVDKMA-AWEZNQCLSA-N |
| XLogP | 2.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|