C12H16N2O3S — CID 55163078
N-(4-aminophenyl)-2-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 55163078) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is N-(4-aminophenyl)-2-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | N-(4-aminophenyl)-2-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 55163078 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | N-(4-aminophenyl)-2-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | Nc1ccc(NC(=O)CC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C12H16N2O3S/c13-10-1-3-11(4-2-10)14-12(15)7-9-5-6-18(16,17)8-9/h1-4,9H,5-8,13H2,(H,14,15) |
| InChIKey | GETHWFPHMTZHCB-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|