C13H14F3NO3S — CID 17463040
2-(1,1-dioxothiolan-3-yl)-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 17463040) has the molecular formula C13H14F3NO3S and a molecular weight of 321.32 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 17463040 |
| Molecular Formula | C13H14F3NO3S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CC1CCS(=O)(=O)C1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3NO3S/c14-13(15,16)10-1-3-11(4-2-10)17-12(18)7-9-5-6-21(19,20)8-9/h1-4,9H,5-8H2,(H,17,18) |
| InChIKey | DXNHRHWWJRGULD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |