C16H23NO3S — CID 18590688
N-(4-butylphenyl)-2-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 18590688) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | N-(4-butylphenyl)-2-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 18590688 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | N-(4-butylphenyl)-2-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | CCCCc1ccc(NC(=O)CC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C16H23NO3S/c1-2-3-4-13-5-7-15(8-6-13)17-16(18)11-14-9-10-21(19,20)12-14/h5-8,14H,2-4,9-12H2,1H3,(H,17,18) |
| InChIKey | QYLIOHBZXSHRMO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |