C17H25N3O3S3 — CID 9272596
1-(4-butylphenyl)-3-[[2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylacetyl]amino]thiourea (PubChem CID 9272596) has the molecular formula C17H25N3O3S3 and a molecular weight of 415.61 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-[[2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylacetyl]amino]thiourea.
| Compound Name | 1-(4-butylphenyl)-3-[[2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylacetyl]amino]thiourea |
|---|---|
| PubChem CID | 9272596 |
| Molecular Formula | C17H25N3O3S3 |
| Molecular Weight | 415.61 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 1-(4-butylphenyl)-3-[[2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylacetyl]amino]thiourea |
| SMILES | CCCCc1ccc(NC(=S)NNC(=O)CS[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C17H25N3O3S3/c1-2-3-4-13-5-7-14(8-6-13)18-17(24)20-19-16(21)11-25-15-9-10-26(22,23)12-15/h5-8,15H,2-4,9-12H2,1H3,(H,19,21)(H2,18,20,24)/t15-/m1/s1 |
| InChIKey | WVCHBIBCAFBNIA-OAHLLOKOSA-N |
| XLogP | 2.27 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.61 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|