C18H27N5O2S — CID 8969879
(3S)-3-[[(4-butylphenyl)carbamothioylamino]carbamoyl]piperidine-1-carboxamide (PubChem CID 8969879) has the molecular formula C18H27N5O2S and a molecular weight of 377.51 g/mol. Its IUPAC name is (3S)-3-[[(4-butylphenyl)carbamothioylamino]carbamoyl]piperidine-1-carboxamide.
| Compound Name | (3S)-3-[[(4-butylphenyl)carbamothioylamino]carbamoyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 8969879 |
| Molecular Formula | C18H27N5O2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | (3S)-3-[[(4-butylphenyl)carbamothioylamino]carbamoyl]piperidine-1-carboxamide |
| SMILES | CCCCc1ccc(NC(=S)NNC(=O)[C@H]2CCCN(C(N)=O)C2)cc1 |
| InChI | InChI=1S/C18H27N5O2S/c1-2-3-5-13-7-9-15(10-8-13)20-18(26)22-21-16(24)14-6-4-11-23(12-14)17(19)25/h7-10,14H,2-6,11-12H2,1H3,(H2,19,25)(H,21,24)(H2,20,22,26)/t14-/m0/s1 |
| InChIKey | BQXCREPSYXPKRG-AWEZNQCLSA-N |
| XLogP | 2.14 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|