C17H26N2S — CID 2946484
N-(4-butylphenyl)-3-methylpiperidine-1-carbothioamide (PubChem CID 2946484) has the molecular formula C17H26N2S and a molecular weight of 290.48 g/mol. Its IUPAC name is N-(4-butylphenyl)-3-methylpiperidine-1-carbothioamide.
| Compound Name | N-(4-butylphenyl)-3-methylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 2946484 |
| Molecular Formula | C17H26N2S |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | N-(4-butylphenyl)-3-methylpiperidine-1-carbothioamide |
| SMILES | CCCCc1ccc(NC(=S)N2CCCC(C)C2)cc1 |
| InChI | InChI=1S/C17H26N2S/c1-3-4-7-15-8-10-16(11-9-15)18-17(20)19-12-5-6-14(2)13-19/h8-11,14H,3-7,12-13H2,1-2H3,(H,18,20) |
| InChIKey | OAWULUMDYNIAHL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|