C13H18N2S — CID 785499
(3S)-3-methyl-N-phenylpiperidine-1-carbothioamide (PubChem CID 785499) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is (3S)-3-methyl-N-phenylpiperidine-1-carbothioamide.
| Compound Name | (3S)-3-methyl-N-phenylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 785499 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (3S)-3-methyl-N-phenylpiperidine-1-carbothioamide |
| SMILES | C[C@H]1CCCN(C(=S)Nc2ccccc2)C1 |
| InChI | InChI=1S/C13H18N2S/c1-11-6-5-9-15(10-11)13(16)14-12-7-3-2-4-8-12/h2-4,7-8,11H,5-6,9-10H2,1H3,(H,14,16)/t11-/m0/s1 |
| InChIKey | ICMAHNUQIBBQKL-NSHDSACASA-N |
| XLogP | 3.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|