C19H22N4S2 — CID 4085607
2-methyl-1-N,4-N-diphenylpiperazine-1,4-dicarbothioamide (PubChem CID 4085607) has the molecular formula C19H22N4S2 and a molecular weight of 370.55 g/mol. Its IUPAC name is 2-methyl-1-N,4-N-diphenylpiperazine-1,4-dicarbothioamide.
| Compound Name | 2-methyl-1-N,4-N-diphenylpiperazine-1,4-dicarbothioamide |
|---|---|
| PubChem CID | 4085607 |
| Molecular Formula | C19H22N4S2 |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-methyl-1-N,4-N-diphenylpiperazine-1,4-dicarbothioamide |
| SMILES | CC1CN(C(=S)Nc2ccccc2)CCN1C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C19H22N4S2/c1-15-14-22(18(24)20-16-8-4-2-5-9-16)12-13-23(15)19(25)21-17-10-6-3-7-11-17/h2-11,15H,12-14H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | KZNKXCFICQBKTP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|