C19H18Cl4N4S2 — CID 20788469
1-N,4-N-bis(3,4-dichlorophenyl)-2-methylpiperazine-1,4-dicarbothioamide (PubChem CID 20788469) has the molecular formula C19H18Cl4N4S2 and a molecular weight of 508.33 g/mol. Its IUPAC name is 1-N,4-N-bis(3,4-dichlorophenyl)-2-methylpiperazine-1,4-dicarbothioamide.
| Compound Name | 1-N,4-N-bis(3,4-dichlorophenyl)-2-methylpiperazine-1,4-dicarbothioamide |
|---|---|
| PubChem CID | 20788469 |
| Molecular Formula | C19H18Cl4N4S2 |
| Molecular Weight | 508.33 g/mol |
| Exact Mass | 505.97 |
| IUPAC Name | 1-N,4-N-bis(3,4-dichlorophenyl)-2-methylpiperazine-1,4-dicarbothioamide |
| SMILES | CC1CN(C(=S)Nc2ccc(Cl)c(Cl)c2)CCN1C(=S)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H18Cl4N4S2/c1-11-10-26(18(28)24-12-2-4-14(20)16(22)8-12)6-7-27(11)19(29)25-13-3-5-15(21)17(23)9-13/h2-5,8-9,11H,6-7,10H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | UDKBDCBPBHRFPB-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.33 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|