C15H20Cl2N2S — CID 2725491
N-(3,4-dichlorophenyl)-5-ethyl-2-methylpiperidine-1-carbothioamide (PubChem CID 2725491) has the molecular formula C15H20Cl2N2S and a molecular weight of 331.31 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-5-ethyl-2-methylpiperidine-1-carbothioamide.
| Compound Name | N-(3,4-dichlorophenyl)-5-ethyl-2-methylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 2725491 |
| Molecular Formula | C15H20Cl2N2S |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N-(3,4-dichlorophenyl)-5-ethyl-2-methylpiperidine-1-carbothioamide |
| SMILES | CCC1CCC(C)N(C(=S)Nc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H20Cl2N2S/c1-3-11-5-4-10(2)19(9-11)15(20)18-12-6-7-13(16)14(17)8-12/h6-8,10-11H,3-5,9H2,1-2H3,(H,18,20) |
| InChIKey | WAVZBASNVSDGEM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|