C19H20Cl2N2S — CID 3383275
4-benzyl-N-(3,4-dichlorophenyl)piperidine-1-carbothioamide (PubChem CID 3383275) has the molecular formula C19H20Cl2N2S and a molecular weight of 379.36 g/mol. Its IUPAC name is 4-benzyl-N-(3,4-dichlorophenyl)piperidine-1-carbothioamide.
| Compound Name | 4-benzyl-N-(3,4-dichlorophenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3383275 |
| Molecular Formula | C19H20Cl2N2S |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 4-benzyl-N-(3,4-dichlorophenyl)piperidine-1-carbothioamide |
| SMILES | S=C(Nc1ccc(Cl)c(Cl)c1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H20Cl2N2S/c20-17-7-6-16(13-18(17)21)22-19(24)23-10-8-15(9-11-23)12-14-4-2-1-3-5-14/h1-7,13,15H,8-12H2,(H,22,24) |
| InChIKey | SNFSCMALTFJPTA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|