C13H17ClN2OS — CID 8677257
N-(3-chloro-4-methylphenyl)-4-hydroxypiperidine-1-carbothioamide (PubChem CID 8677257) has the molecular formula C13H17ClN2OS and a molecular weight of 284.81 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-4-hydroxypiperidine-1-carbothioamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-4-hydroxypiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 8677257 |
| Molecular Formula | C13H17ClN2OS |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-4-hydroxypiperidine-1-carbothioamide |
| SMILES | Cc1ccc(NC(=S)N2CCC(O)CC2)cc1Cl |
| InChI | InChI=1S/C13H17ClN2OS/c1-9-2-3-10(8-12(9)14)15-13(18)16-6-4-11(17)5-7-16/h2-3,8,11,17H,4-7H2,1H3,(H,15,18) |
| InChIKey | HXOUFJZLUZENGA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|