C17H24ClN4OS+ — CID 9097200
2-[4-[(3-chloro-4-methylphenyl)carbamothioyl]piperazin-1-ium-1-yl]-N-cyclopropylacetamide (PubChem CID 9097200) has the molecular formula C17H24ClN4OS+ and a molecular weight of 367.93 g/mol. Its IUPAC name is 2-[4-[(3-chloro-4-methylphenyl)carbamothioyl]piperazin-1-ium-1-yl]-N-cyclopropylacetamide.
| Compound Name | 2-[4-[(3-chloro-4-methylphenyl)carbamothioyl]piperazin-1-ium-1-yl]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 9097200 |
| Molecular Formula | C17H24ClN4OS+ |
| Molecular Weight | 367.93 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-[4-[(3-chloro-4-methylphenyl)carbamothioyl]piperazin-1-ium-1-yl]-N-cyclopropylacetamide |
| SMILES | Cc1ccc(NC(=S)N2CC[NH+](CC(=O)NC3CC3)CC2)cc1Cl |
| InChI | InChI=1S/C17H23ClN4OS/c1-12-2-3-14(10-15(12)18)20-17(24)22-8-6-21(7-9-22)11-16(23)19-13-4-5-13/h2-3,10,13H,4-9,11H2,1H3,(H,19,23)(H,20,24)/p+1 |
| InChIKey | AMOJLWQHOWIZPR-UHFFFAOYSA-O |
| XLogP | 0.82 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.93 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|