C22H29N4OS+ — CID 9215195
N-(2,3-dimethylphenyl)-2-[4-[(4-methylphenyl)carbamothioyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 9215195) has the molecular formula C22H29N4OS+ and a molecular weight of 397.57 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[4-[(4-methylphenyl)carbamothioyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[4-[(4-methylphenyl)carbamothioyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9215195 |
| Molecular Formula | C22H29N4OS+ |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[4-[(4-methylphenyl)carbamothioyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=S)N2CC[NH+](CC(=O)Nc3cccc(C)c3C)CC2)cc1 |
| InChI | InChI=1S/C22H28N4OS/c1-16-7-9-19(10-8-16)23-22(28)26-13-11-25(12-14-26)15-21(27)24-20-6-4-5-17(2)18(20)3/h4-10H,11-15H2,1-3H3,(H,23,28)(H,24,27)/p+1 |
| InChIKey | GWIWVVWXTJBFJH-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|