C18H27N4OS+ — CID 9215160
N-(2,3-dimethylphenyl)-2-[4-(prop-2-enylcarbamothioyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 9215160) has the molecular formula C18H27N4OS+ and a molecular weight of 347.51 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[4-(prop-2-enylcarbamothioyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[4-(prop-2-enylcarbamothioyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9215160 |
| Molecular Formula | C18H27N4OS+ |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[4-(prop-2-enylcarbamothioyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | C=CCNC(=S)N1CC[NH+](CC(=O)Nc2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C18H26N4OS/c1-4-8-19-18(24)22-11-9-21(10-12-22)13-17(23)20-16-7-5-6-14(2)15(16)3/h4-7H,1,8-13H2,2-3H3,(H,19,24)(H,20,23)/p+1 |
| InChIKey | KZRANUCAEPZUGF-UHFFFAOYSA-O |
| XLogP | 0.50 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|