C17H24ClN4O3+ — CID 9033863
2-[[2-(4-acetylpiperazin-1-ium-1-yl)acetyl]amino]-N-(3-chloro-2-methylphenyl)acetamide (PubChem CID 9033863) has the molecular formula C17H24ClN4O3+ and a molecular weight of 367.86 g/mol. Its IUPAC name is 2-[[2-(4-acetylpiperazin-1-ium-1-yl)acetyl]amino]-N-(3-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-[[2-(4-acetylpiperazin-1-ium-1-yl)acetyl]amino]-N-(3-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 9033863 |
| Molecular Formula | C17H24ClN4O3+ |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-[[2-(4-acetylpiperazin-1-ium-1-yl)acetyl]amino]-N-(3-chloro-2-methylphenyl)acetamide |
| SMILES | CC(=O)N1CC[NH+](CC(=O)NCC(=O)Nc2cccc(Cl)c2C)CC1 |
| InChI | InChI=1S/C17H23ClN4O3/c1-12-14(18)4-3-5-15(12)20-16(24)10-19-17(25)11-21-6-8-22(9-7-21)13(2)23/h3-5H,6-11H2,1-2H3,(H,19,25)(H,20,24)/p+1 |
| InChIKey | YYYAXLDLOMPLOC-UHFFFAOYSA-O |
| XLogP | -0.55 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |