C13H18ClN2O2+ — CID 6993865
N-(3-chloro-2-methylphenyl)-2-morpholin-4-ium-4-ylacetamide (PubChem CID 6993865) has the molecular formula C13H18ClN2O2+ and a molecular weight of 269.75 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-morpholin-4-ium-4-ylacetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-morpholin-4-ium-4-ylacetamide |
|---|---|
| PubChem CID | 6993865 |
| Molecular Formula | C13H18ClN2O2+ |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-morpholin-4-ium-4-ylacetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C[NH+]1CCOCC1 |
| InChI | InChI=1S/C13H17ClN2O2/c1-10-11(14)3-2-4-12(10)15-13(17)9-16-5-7-18-8-6-16/h2-4H,5-9H2,1H3,(H,15,17)/p+1 |
| InChIKey | DNZVWXBQUZUCSH-UHFFFAOYSA-O |
| XLogP | 0.50 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |