C22H23Cl2N3O3 — CID 17498503
1-(4-chlorobenzoyl)-N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 17498503) has the molecular formula C22H23Cl2N3O3 and a molecular weight of 448.35 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-chlorobenzoyl)-N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17498503 |
| Molecular Formula | C22H23Cl2N3O3 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CNC(=O)C1CCN(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H23Cl2N3O3/c1-14-18(24)3-2-4-19(14)26-20(28)13-25-21(29)15-9-11-27(12-10-15)22(30)16-5-7-17(23)8-6-16/h2-8,15H,9-13H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | KGGBVDZNIDRWLF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |